C16H23N3O2 — CID 105070810
(4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl)-[3-(methylamino)-4-pyridinyl]methanone (PubChem CID 105070810) has the molecular formula C16H23N3O2 and a molecular weight of 289.38 g/mol. Its IUPAC name is (4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl)-[3-(methylamino)-4-pyridinyl]methanone.
| Compound Name | (4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl)-[3-(methylamino)-4-pyridinyl]methanone |
|---|---|
| PubChem CID | 105070810 |
| Molecular Formula | C16H23N3O2 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | (4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl)-[3-(methylamino)-4-pyridinyl]methanone |
| SMILES | CNc1cnccc1C(=O)N1CCC2(O)CCCCC2C1 |
| InChI | InChI=1S/C16H23N3O2/c1-17-14-10-18-8-5-13(14)15(20)19-9-7-16(21)6-3-2-4-12(16)11-19/h5,8,10,12,17,21H,2-4,6-7,9,11H2,1H3 |
| InChIKey | BGTOLWZWBMFXHH-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |