C23H36Cl4O5Si — CID 10507121
tert-butyl-dimethyl-[[(1S,2S,3R,6S,7R,8R)-1,8,9,10-tetrachloro-6-(1-ethoxyethoxy)-11,11-dimethoxy-3-tricyclo[6.2.1.02,7]undeca-4,9-dienyl]oxy]silane (PubChem CID 10507121) has the molecular formula C23H36Cl4O5Si and a molecular weight of 562.43 g/mol. Its IUPAC name is tert-butyl-dimethyl-[[(1S,2S,3R,6S,7R,8R)-1,8,9,10-tetrachloro-6-(1-ethoxyethoxy)-11,11-dimethoxy-3-tricyclo[6.2.1.02,7]undeca-4,9-dienyl]oxy]silane.
| Compound Name | tert-butyl-dimethyl-[[(1S,2S,3R,6S,7R,8R)-1,8,9,10-tetrachloro-6-(1-ethoxyethoxy)-11,11-dimethoxy-3-tricyclo[6.2.1.02,7]undeca-4,9-dienyl]oxy]silane |
|---|---|
| PubChem CID | 10507121 |
| Molecular Formula | C23H36Cl4O5Si |
| Molecular Weight | 562.43 g/mol |
| Exact Mass | 560.11 |
| IUPAC Name | tert-butyl-dimethyl-[[(1S,2S,3R,6S,7R,8R)-1,8,9,10-tetrachloro-6-(1-ethoxyethoxy)-11,11-dimethoxy-3-tricyclo[6.2.1.02,7]undeca-4,9-dienyl]oxy]silane |
| SMILES | CCOC(C)O[C@H]1C=C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2[C@H]1[C@]1(Cl)C(Cl)=C(Cl)[C@@]2(Cl)C1(OC)OC |
| InChI | InChI=1S/C23H36Cl4O5Si/c1-10-30-13(2)31-14-11-12-15(32-33(8,9)20(3,4)5)17-16(14)21(26)18(24)19(25)22(17,27)23(21,28-6)29-7/h11-17H,10H2,1-9H3/t13?,14-,15+,16-,17+,21-,22+/m0/s1 |
| InChIKey | XSMQJQPEVRNZRF-SEMYATEBSA-N |
| XLogP | 6.61 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.43 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|