C16H27N3O2 — CID 105071243
N-(3-butoxypropyl)-3-(propylamino)pyridine-4-carboxamide (PubChem CID 105071243) has the molecular formula C16H27N3O2 and a molecular weight of 293.41 g/mol. Its IUPAC name is N-(3-butoxypropyl)-3-(propylamino)pyridine-4-carboxamide.
| Compound Name | N-(3-butoxypropyl)-3-(propylamino)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 105071243 |
| Molecular Formula | C16H27N3O2 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.21 |
| IUPAC Name | N-(3-butoxypropyl)-3-(propylamino)pyridine-4-carboxamide |
| SMILES | CCCCOCCCNC(=O)c1ccncc1NCCC |
| InChI | InChI=1S/C16H27N3O2/c1-3-5-11-21-12-6-9-19-16(20)14-7-10-17-13-15(14)18-8-4-2/h7,10,13,18H,3-6,8-9,11-12H2,1-2H3,(H,19,20) |
| InChIKey | FBUATCZCUSLQQD-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|