C12H20N4O — CID 105071655
N-hexan-3-yl-3-hydrazinylpyridine-4-carboxamide (PubChem CID 105071655) has the molecular formula C12H20N4O and a molecular weight of 236.32 g/mol. Its IUPAC name is N-hexan-3-yl-3-hydrazinylpyridine-4-carboxamide.
| Compound Name | N-hexan-3-yl-3-hydrazinylpyridine-4-carboxamide |
|---|---|
| PubChem CID | 105071655 |
| Molecular Formula | C12H20N4O |
| Molecular Weight | 236.32 g/mol |
| Exact Mass | 236.16 |
| IUPAC Name | N-hexan-3-yl-3-hydrazinylpyridine-4-carboxamide |
| SMILES | CCCC(CC)NC(=O)c1ccncc1NN |
| InChI | InChI=1S/C12H20N4O/c1-3-5-9(4-2)15-12(17)10-6-7-14-8-11(10)16-13/h6-9,16H,3-5,13H2,1-2H3,(H,15,17) |
| InChIKey | CFEBQYNKNPQJCY-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.32 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|