C26H44O13 — CID 10507175
tritert-butyl (1S,3S,4S,5R,6R,7R)-1-(3,3-dimethoxypropyl)-4,6,7-trihydroxy-2,8-dioxabicyclo[3.2.1]octane-3,4,5-tricarboxylate (PubChem CID 10507175) has the molecular formula C26H44O13 and a molecular weight of 564.63 g/mol. Its IUPAC name is tritert-butyl (1S,3S,4S,5R,6R,7R)-1-(3,3-dimethoxypropyl)-4,6,7-trihydroxy-2,8-dioxabicyclo[3.2.1]octane-3,4,5-tricarboxylate.
| Compound Name | tritert-butyl (1S,3S,4S,5R,6R,7R)-1-(3,3-dimethoxypropyl)-4,6,7-trihydroxy-2,8-dioxabicyclo[3.2.1]octane-3,4,5-tricarboxylate |
|---|---|
| PubChem CID | 10507175 |
| Molecular Formula | C26H44O13 |
| Molecular Weight | 564.63 g/mol |
| Exact Mass | 564.28 |
| IUPAC Name | tritert-butyl (1S,3S,4S,5R,6R,7R)-1-(3,3-dimethoxypropyl)-4,6,7-trihydroxy-2,8-dioxabicyclo[3.2.1]octane-3,4,5-tricarboxylate |
| SMILES | COC(CC[C@]12O[C@H](C(=O)OC(C)(C)C)[C@@](O)(C(=O)OC(C)(C)C)[C@](C(=O)OC(C)(C)C)(O1)[C@H](O)[C@H]2O)OC |
| InChI | InChI=1S/C26H44O13/c1-21(2,3)36-18(29)17-25(32,19(30)37-22(4,5)6)26(20(31)38-23(7,8)9)16(28)15(27)24(35-17,39-26)13-12-14(33-10)34-11/h14-17,27-28,32H,12-13H2,1-11H3/t15-,16-,17-,24+,25-,26+/m1/s1 |
| InChIKey | BWDXSKVDRRZJPQ-LXBOXMHASA-N |
| XLogP | 0.73 |
| TPSA | 176.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.63 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|