C13H13FN4O — CID 105071773
N-(3-fluoro-4-methylphenyl)-3-hydrazinylpyridine-4-carboxamide (PubChem CID 105071773) has the molecular formula C13H13FN4O and a molecular weight of 260.27 g/mol. Its IUPAC name is N-(3-fluoro-4-methylphenyl)-3-hydrazinylpyridine-4-carboxamide.
| Compound Name | N-(3-fluoro-4-methylphenyl)-3-hydrazinylpyridine-4-carboxamide |
|---|---|
| PubChem CID | 105071773 |
| Molecular Formula | C13H13FN4O |
| Molecular Weight | 260.27 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | N-(3-fluoro-4-methylphenyl)-3-hydrazinylpyridine-4-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2ccncc2NN)cc1F |
| InChI | InChI=1S/C13H13FN4O/c1-8-2-3-9(6-11(8)14)17-13(19)10-4-5-16-7-12(10)18-15/h2-7,18H,15H2,1H3,(H,17,19) |
| InChIKey | DITBIJZRSWRCKN-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.27 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|