C11H18N4O — CID 105072006
N-ethyl-3-hydrazinyl-N-propylpyridine-4-carboxamide (PubChem CID 105072006) has the molecular formula C11H18N4O and a molecular weight of 222.29 g/mol. Its IUPAC name is N-ethyl-3-hydrazinyl-N-propylpyridine-4-carboxamide.
| Compound Name | N-ethyl-3-hydrazinyl-N-propylpyridine-4-carboxamide |
|---|---|
| PubChem CID | 105072006 |
| Molecular Formula | C11H18N4O |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.15 |
| IUPAC Name | N-ethyl-3-hydrazinyl-N-propylpyridine-4-carboxamide |
| SMILES | CCCN(CC)C(=O)c1ccncc1NN |
| InChI | InChI=1S/C11H18N4O/c1-3-7-15(4-2)11(16)9-5-6-13-8-10(9)14-12/h5-6,8,14H,3-4,7,12H2,1-2H3 |
| InChIKey | NJEIQMGFCNZTIZ-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|