C12H19N3 — CID 105072608
N-[(3-pyrrolidin-1-yl-4-pyridinyl)methyl]ethanamine (PubChem CID 105072608) has the molecular formula C12H19N3 and a molecular weight of 205.30 g/mol. Its IUPAC name is N-[(3-pyrrolidin-1-yl-4-pyridinyl)methyl]ethanamine.
| Compound Name | N-[(3-pyrrolidin-1-yl-4-pyridinyl)methyl]ethanamine |
|---|---|
| PubChem CID | 105072608 |
| Molecular Formula | C12H19N3 |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.16 |
| IUPAC Name | N-[(3-pyrrolidin-1-yl-4-pyridinyl)methyl]ethanamine |
| SMILES | CCNCc1ccncc1N1CCCC1 |
| InChI | InChI=1S/C12H19N3/c1-2-13-9-11-5-6-14-10-12(11)15-7-3-4-8-15/h5-6,10,13H,2-4,7-9H2,1H3 |
| InChIKey | NDKMBSXLCPFDHO-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |