C18H33N3 — CID 105072835
N,N-dibutyl-4-[(tert-butylamino)methyl]pyridin-3-amine (PubChem CID 105072835) has the molecular formula C18H33N3 and a molecular weight of 291.48 g/mol. Its IUPAC name is N,N-dibutyl-4-[(tert-butylamino)methyl]pyridin-3-amine.
| Compound Name | N,N-dibutyl-4-[(tert-butylamino)methyl]pyridin-3-amine |
|---|---|
| PubChem CID | 105072835 |
| Molecular Formula | C18H33N3 |
| Molecular Weight | 291.48 g/mol |
| Exact Mass | 291.27 |
| IUPAC Name | N,N-dibutyl-4-[(tert-butylamino)methyl]pyridin-3-amine |
| SMILES | CCCCN(CCCC)c1cnccc1CNC(C)(C)C |
| InChI | InChI=1S/C18H33N3/c1-6-8-12-21(13-9-7-2)17-15-19-11-10-16(17)14-20-18(3,4)5/h10-11,15,20H,6-9,12-14H2,1-5H3 |
| InChIKey | QGNNJZHLKGNNEV-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.48 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |