C30H36O9S — CID 10507317
dimethyl (1S,2S,4S,5R,12S)-12-acetyloxy-4-methyl-13-methylidene-5-(4-methylphenyl)sulfonyloxytetracyclo[10.2.1.01,9.03,8]pentadec-7-ene-2,4-dicarboxylate (PubChem CID 10507317) has the molecular formula C30H36O9S and a molecular weight of 572.68 g/mol. Its IUPAC name is dimethyl (1S,2S,4S,5R,12S)-12-acetyloxy-4-methyl-13-methylidene-5-(4-methylphenyl)sulfonyloxytetracyclo[10.2.1.01,9.03,8]pentadec-7-ene-2,4-dicarboxylate.
| Compound Name | dimethyl (1S,2S,4S,5R,12S)-12-acetyloxy-4-methyl-13-methylidene-5-(4-methylphenyl)sulfonyloxytetracyclo[10.2.1.01,9.03,8]pentadec-7-ene-2,4-dicarboxylate |
|---|---|
| PubChem CID | 10507317 |
| Molecular Formula | C30H36O9S |
| Molecular Weight | 572.68 g/mol |
| Exact Mass | 572.21 |
| IUPAC Name | dimethyl (1S,2S,4S,5R,12S)-12-acetyloxy-4-methyl-13-methylidene-5-(4-methylphenyl)sulfonyloxytetracyclo[10.2.1.01,9.03,8]pentadec-7-ene-2,4-dicarboxylate |
| SMILES | C=C1C[C@]23C[C@@]1(OC(C)=O)CCC2C1=CC[C@@H](OS(=O)(=O)c2ccc(C)cc2)[C@@](C)(C(=O)OC)C1[C@@H]3C(=O)OC |
| InChI | InChI=1S/C30H36O9S/c1-17-7-9-20(10-8-17)40(34,35)39-23-12-11-21-22-13-14-30(38-19(3)31)16-29(22,15-18(30)2)25(26(32)36-5)24(21)28(23,4)27(33)37-6/h7-11,22-25H,2,12-16H2,1,3-6H3/t22?,23-,24?,25-,28-,29+,30+/m1/s1 |
| InChIKey | DEWOBMHIBSVMIO-NKCFNEPKSA-N |
| XLogP | 4.05 |
| TPSA | 122.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.68 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|