C31H44O6SSi — CID 10507331
ethyl (4S,7Z,11R,12Z)-11-[tert-butyl(dimethyl)silyl]oxy-14-hydroxy-4-(methoxymethoxy)-11-methyl-12-phenylsulfanyltetradeca-7,12-dien-5,9-diynoate (PubChem CID 10507331) has the molecular formula C31H44O6SSi and a molecular weight of 572.84 g/mol. Its IUPAC name is ethyl (4S,7Z,11R,12Z)-11-[tert-butyl(dimethyl)silyl]oxy-14-hydroxy-4-(methoxymethoxy)-11-methyl-12-phenylsulfanyltetradeca-7,12-dien-5,9-diynoate.
| Compound Name | ethyl (4S,7Z,11R,12Z)-11-[tert-butyl(dimethyl)silyl]oxy-14-hydroxy-4-(methoxymethoxy)-11-methyl-12-phenylsulfanyltetradeca-7,12-dien-5,9-diynoate |
|---|---|
| PubChem CID | 10507331 |
| Molecular Formula | C31H44O6SSi |
| Molecular Weight | 572.84 g/mol |
| Exact Mass | 572.26 |
| IUPAC Name | ethyl (4S,7Z,11R,12Z)-11-[tert-butyl(dimethyl)silyl]oxy-14-hydroxy-4-(methoxymethoxy)-11-methyl-12-phenylsulfanyltetradeca-7,12-dien-5,9-diynoate |
| SMILES | CCOC(=O)CC[C@@H](C#C/C=C\C#C[C@@](C)(O[Si](C)(C)C(C)(C)C)/C(=C/CO)Sc1ccccc1)OCOC |
| InChI | InChI=1S/C31H44O6SSi/c1-9-35-29(33)21-20-26(36-25-34-6)17-13-10-11-16-23-31(5,37-39(7,8)30(2,3)4)28(22-24-32)38-27-18-14-12-15-19-27/h10-12,14-15,18-19,22,26,32H,9,20-21,24-25H2,1-8H3/b11-10-,28-22-/t26-,31-/m1/s1 |
| InChIKey | NDEZDAMQCFXLLX-BFBHVSFXSA-N |
| XLogP | 6.33 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.84 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|