C16H21N3O — CID 105073319
4-(ethylaminomethyl)-N-(3-methoxyphenyl)-N-methylpyridin-3-amine (PubChem CID 105073319) has the molecular formula C16H21N3O and a molecular weight of 271.36 g/mol. Its IUPAC name is 4-(ethylaminomethyl)-N-(3-methoxyphenyl)-N-methylpyridin-3-amine.
| Compound Name | 4-(ethylaminomethyl)-N-(3-methoxyphenyl)-N-methylpyridin-3-amine |
|---|---|
| PubChem CID | 105073319 |
| Molecular Formula | C16H21N3O |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.17 |
| IUPAC Name | 4-(ethylaminomethyl)-N-(3-methoxyphenyl)-N-methylpyridin-3-amine |
| SMILES | CCNCc1ccncc1N(C)c1cccc(OC)c1 |
| InChI | InChI=1S/C16H21N3O/c1-4-17-11-13-8-9-18-12-16(13)19(2)14-6-5-7-15(10-14)20-3/h5-10,12,17H,4,11H2,1-3H3 |
| InChIKey | ZKSRLVSJADNSHQ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |