C18H23N3 — CID 105073338
4-[(cyclopropylamino)methyl]-N-ethyl-N-(4-methylphenyl)pyridin-3-amine (PubChem CID 105073338) has the molecular formula C18H23N3 and a molecular weight of 281.40 g/mol. Its IUPAC name is 4-[(cyclopropylamino)methyl]-N-ethyl-N-(4-methylphenyl)pyridin-3-amine.
| Compound Name | 4-[(cyclopropylamino)methyl]-N-ethyl-N-(4-methylphenyl)pyridin-3-amine |
|---|---|
| PubChem CID | 105073338 |
| Molecular Formula | C18H23N3 |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.19 |
| IUPAC Name | 4-[(cyclopropylamino)methyl]-N-ethyl-N-(4-methylphenyl)pyridin-3-amine |
| SMILES | CCN(c1ccc(C)cc1)c1cnccc1CNC1CC1 |
| InChI | InChI=1S/C18H23N3/c1-3-21(17-8-4-14(2)5-9-17)18-13-19-11-10-15(18)12-20-16-6-7-16/h4-5,8-11,13,16,20H,3,6-7,12H2,1-2H3 |
| InChIKey | KASDSKGLXRWHMY-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |