C35H36N2O4Si — CID 10507402
N-[3-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,4-dimethylphenyl]-2-(1,3-dioxoisoindol-2-yl)acetamide (PubChem CID 10507402) has the molecular formula C35H36N2O4Si and a molecular weight of 576.77 g/mol. Its IUPAC name is N-[3-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,4-dimethylphenyl]-2-(1,3-dioxoisoindol-2-yl)acetamide.
| Compound Name | N-[3-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,4-dimethylphenyl]-2-(1,3-dioxoisoindol-2-yl)acetamide |
|---|---|
| PubChem CID | 10507402 |
| Molecular Formula | C35H36N2O4Si |
| Molecular Weight | 576.77 g/mol |
| Exact Mass | 576.24 |
| IUPAC Name | N-[3-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,4-dimethylphenyl]-2-(1,3-dioxoisoindol-2-yl)acetamide |
| SMILES | Cc1ccc(NC(=O)CN2C(=O)c3ccccc3C2=O)c(C)c1CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C35H36N2O4Si/c1-24-20-21-31(36-32(38)22-37-33(39)28-18-12-13-19-29(28)34(37)40)25(2)30(24)23-41-42(35(3,4)5,26-14-8-6-9-15-26)27-16-10-7-11-17-27/h6-21H,22-23H2,1-5H3,(H,36,38) |
| InChIKey | JITLCSSWJHKJHA-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.77 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|