C34H56S2Si2 — CID 10507552
[6,13-ditert-butyl-2,10-bis(methylsulfanyl)-16-(trimethylsilylmethyl)-15-tricyclo[9.3.1.14,8]hexadeca-1(14),4,6,8(16),11(15),12-hexaenyl]methyl-trimethylsilane (PubChem CID 10507552) has the molecular formula C34H56S2Si2 and a molecular weight of 585.13 g/mol. Its IUPAC name is [6,13-ditert-butyl-2,10-bis(methylsulfanyl)-16-(trimethylsilylmethyl)-15-tricyclo[9.3.1.14,8]hexadeca-1(14),4,6,8(16),11(15),12-hexaenyl]methyl-trimethylsilane.
| Compound Name | [6,13-ditert-butyl-2,10-bis(methylsulfanyl)-16-(trimethylsilylmethyl)-15-tricyclo[9.3.1.14,8]hexadeca-1(14),4,6,8(16),11(15),12-hexaenyl]methyl-trimethylsilane |
|---|---|
| PubChem CID | 10507552 |
| Molecular Formula | C34H56S2Si2 |
| Molecular Weight | 585.13 g/mol |
| Exact Mass | 584.34 |
| IUPAC Name | [6,13-ditert-butyl-2,10-bis(methylsulfanyl)-16-(trimethylsilylmethyl)-15-tricyclo[9.3.1.14,8]hexadeca-1(14),4,6,8(16),11(15),12-hexaenyl]methyl-trimethylsilane |
| SMILES | CSC1Cc2cc(C(C)(C)C)cc(c2C[Si](C)(C)C)CC(SC)c2cc(C(C)(C)C)cc1c2C[Si](C)(C)C |
| InChI | InChI=1S/C34H56S2Si2/c1-33(2,3)25-15-23-17-31(35-7)27-19-26(34(4,5)6)20-28(30(27)22-38(12,13)14)32(36-8)18-24(16-25)29(23)21-37(9,10)11/h15-16,19-20,31-32H,17-18,21-22H2,1-14H3 |
| InChIKey | YIXZPQVBXDPBAL-UHFFFAOYSA-N |
| XLogP | 10.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.13 |
| LogP ≤ 5 | 10.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|