C35H31N5O4 — CID 10507561
N-[2,4-dioxo-1-[2-oxo-2-(N-propan-2-ylanilino)ethyl]-5-phenyl-1,5-benzodiazepin-3-yl]-1H-indole-2-carboxamide (PubChem CID 10507561) has the molecular formula C35H31N5O4 and a molecular weight of 585.66 g/mol. Its IUPAC name is N-[2,4-dioxo-1-[2-oxo-2-(N-propan-2-ylanilino)ethyl]-5-phenyl-1,5-benzodiazepin-3-yl]-1H-indole-2-carboxamide.
| Compound Name | N-[2,4-dioxo-1-[2-oxo-2-(N-propan-2-ylanilino)ethyl]-5-phenyl-1,5-benzodiazepin-3-yl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 10507561 |
| Molecular Formula | C35H31N5O4 |
| Molecular Weight | 585.66 g/mol |
| Exact Mass | 585.24 |
| IUPAC Name | N-[2,4-dioxo-1-[2-oxo-2-(N-propan-2-ylanilino)ethyl]-5-phenyl-1,5-benzodiazepin-3-yl]-1H-indole-2-carboxamide |
| SMILES | CC(C)N(C(=O)CN1C(=O)C(NC(=O)c2cc3ccccc3[nH]2)C(=O)N(c2ccccc2)c2ccccc21)c1ccccc1 |
| InChI | InChI=1S/C35H31N5O4/c1-23(2)39(25-14-5-3-6-15-25)31(41)22-38-29-19-11-12-20-30(29)40(26-16-7-4-8-17-26)35(44)32(34(38)43)37-33(42)28-21-24-13-9-10-18-27(24)36-28/h3-21,23,32,36H,22H2,1-2H3,(H,37,42) |
| InChIKey | IAYFRXOMWAZQGV-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 105.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.66 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|