C35H62O3Si2 — CID 10507587
tert-butyl-[2-[(5R)-5-[(Z,1S)-1-(methoxymethoxy)-7-tri(propan-2-yl)silylhept-4-en-2,6-diynyl]-2,6,6-trimethylcyclohexen-1-yl]ethoxy]-dimethylsilane (PubChem CID 10507587) has the molecular formula C35H62O3Si2 and a molecular weight of 587.05 g/mol. Its IUPAC name is tert-butyl-[2-[(5R)-5-[(Z,1S)-1-(methoxymethoxy)-7-tri(propan-2-yl)silylhept-4-en-2,6-diynyl]-2,6,6-trimethylcyclohexen-1-yl]ethoxy]-dimethylsilane.
| Compound Name | tert-butyl-[2-[(5R)-5-[(Z,1S)-1-(methoxymethoxy)-7-tri(propan-2-yl)silylhept-4-en-2,6-diynyl]-2,6,6-trimethylcyclohexen-1-yl]ethoxy]-dimethylsilane |
|---|---|
| PubChem CID | 10507587 |
| Molecular Formula | C35H62O3Si2 |
| Molecular Weight | 587.05 g/mol |
| Exact Mass | 586.42 |
| IUPAC Name | tert-butyl-[2-[(5R)-5-[(Z,1S)-1-(methoxymethoxy)-7-tri(propan-2-yl)silylhept-4-en-2,6-diynyl]-2,6,6-trimethylcyclohexen-1-yl]ethoxy]-dimethylsilane |
| SMILES | COCO[C@H](C#C/C=C\C#C[Si](C(C)C)(C(C)C)C(C)C)[C@@H]1CCC(C)=C(CCO[Si](C)(C)C(C)(C)C)C1(C)C |
| InChI | InChI=1S/C35H62O3Si2/c1-27(2)40(28(3)4,29(5)6)25-19-17-16-18-20-33(37-26-36-13)32-22-21-30(7)31(35(32,11)12)23-24-38-39(14,15)34(8,9)10/h16-17,27-29,32-33H,21-24,26H2,1-15H3/b17-16-/t32-,33+/m0/s1 |
| InChIKey | GCRFCIXCVZICDZ-XFXDHMIVSA-N |
| XLogP | 9.92 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.05 |
| LogP ≤ 5 | 9.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|