C12H11BrClNS — CID 105076520
1-(5-bromothiophen-3-yl)-1-(4-chlorophenyl)-N-methylmethanamine (PubChem CID 105076520) has the molecular formula C12H11BrClNS and a molecular weight of 316.65 g/mol. Its IUPAC name is 1-(5-bromothiophen-3-yl)-1-(4-chlorophenyl)-N-methylmethanamine.
| Compound Name | 1-(5-bromothiophen-3-yl)-1-(4-chlorophenyl)-N-methylmethanamine |
|---|---|
| PubChem CID | 105076520 |
| Molecular Formula | C12H11BrClNS |
| Molecular Weight | 316.65 g/mol |
| Exact Mass | 314.95 |
| IUPAC Name | 1-(5-bromothiophen-3-yl)-1-(4-chlorophenyl)-N-methylmethanamine |
| SMILES | CNC(c1ccc(Cl)cc1)c1csc(Br)c1 |
| InChI | InChI=1S/C12H11BrClNS/c1-15-12(9-6-11(13)16-7-9)8-2-4-10(14)5-3-8/h2-7,12,15H,1H3 |
| InChIKey | MLDOCXOSDYVKEM-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.65 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |