C10H14N2O — CID 105076537
1-(3,6-dimethylpyridazin-4-yl)-2-methylpropan-1-one (PubChem CID 105076537) has the molecular formula C10H14N2O and a molecular weight of 178.23 g/mol. Its IUPAC name is 1-(3,6-dimethylpyridazin-4-yl)-2-methylpropan-1-one.
| Compound Name | 1-(3,6-dimethylpyridazin-4-yl)-2-methylpropan-1-one |
|---|---|
| PubChem CID | 105076537 |
| Molecular Formula | C10H14N2O |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.11 |
| IUPAC Name | 1-(3,6-dimethylpyridazin-4-yl)-2-methylpropan-1-one |
| SMILES | Cc1cc(C(=O)C(C)C)c(C)nn1 |
| InChI | InChI=1S/C10H14N2O/c1-6(2)10(13)9-5-7(3)11-12-8(9)4/h5-6H,1-4H3 |
| InChIKey | TVGNAZIDKSEPPV-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |