C40H39N3O2 — CID 10507700
N-[3-(1H-indol-3-yl)-2-(tritylamino)propyl]-N-[(3-methoxyphenyl)methyl]acetamide (PubChem CID 10507700) has the molecular formula C40H39N3O2 and a molecular weight of 593.77 g/mol. Its IUPAC name is N-[3-(1H-indol-3-yl)-2-(tritylamino)propyl]-N-[(3-methoxyphenyl)methyl]acetamide.
| Compound Name | N-[3-(1H-indol-3-yl)-2-(tritylamino)propyl]-N-[(3-methoxyphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 10507700 |
| Molecular Formula | C40H39N3O2 |
| Molecular Weight | 593.77 g/mol |
| Exact Mass | 593.30 |
| IUPAC Name | N-[3-(1H-indol-3-yl)-2-(tritylamino)propyl]-N-[(3-methoxyphenyl)methyl]acetamide |
| SMILES | COc1cccc(CN(CC(Cc2c[nH]c3ccccc23)NC(c2ccccc2)(c2ccccc2)c2ccccc2)C(C)=O)c1 |
| InChI | InChI=1S/C40H39N3O2/c1-30(44)43(28-31-15-14-22-37(25-31)45-2)29-36(26-32-27-41-39-24-13-12-23-38(32)39)42-40(33-16-6-3-7-17-33,34-18-8-4-9-19-34)35-20-10-5-11-21-35/h3-25,27,36,41-42H,26,28-29H2,1-2H3 |
| InChIKey | WYRMLCWYGQABMS-UHFFFAOYSA-N |
| XLogP | 7.72 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.77 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|