C35H39N3O6 — CID 10507750
3-(3-methyl-1,4-dioxonaphthalen-2-yl)-N-[4-[3-[3-(3-methyl-1,4-dioxonaphthalen-2-yl)propanoylamino]propylamino]butyl]propanamide (PubChem CID 10507750) has the molecular formula C35H39N3O6 and a molecular weight of 597.71 g/mol. Its IUPAC name is 3-(3-methyl-1,4-dioxonaphthalen-2-yl)-N-[4-[3-[3-(3-methyl-1,4-dioxonaphthalen-2-yl)propanoylamino]propylamino]butyl]propanamide.
| Compound Name | 3-(3-methyl-1,4-dioxonaphthalen-2-yl)-N-[4-[3-[3-(3-methyl-1,4-dioxonaphthalen-2-yl)propanoylamino]propylamino]butyl]propanamide |
|---|---|
| PubChem CID | 10507750 |
| Molecular Formula | C35H39N3O6 |
| Molecular Weight | 597.71 g/mol |
| Exact Mass | 597.28 |
| IUPAC Name | 3-(3-methyl-1,4-dioxonaphthalen-2-yl)-N-[4-[3-[3-(3-methyl-1,4-dioxonaphthalen-2-yl)propanoylamino]propylamino]butyl]propanamide |
| SMILES | CC1=C(CCC(=O)NCCCCNCCCNC(=O)CCC2=C(C)C(=O)c3ccccc3C2=O)C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C35H39N3O6/c1-22-24(34(43)28-12-5-3-10-26(28)32(22)41)14-16-30(39)37-20-8-7-18-36-19-9-21-38-31(40)17-15-25-23(2)33(42)27-11-4-6-13-29(27)35(25)44/h3-6,10-13,36H,7-9,14-21H2,1-2H3,(H,37,39)(H,38,40) |
| InChIKey | IPZWSAHLJQLDLK-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 138.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.71 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|