C14H17N3 — CID 105077571
1-(benzimidazol-1-yl)-N-ethylpent-4-yn-2-amine (PubChem CID 105077571) has the molecular formula C14H17N3 and a molecular weight of 227.31 g/mol. Its IUPAC name is 1-(benzimidazol-1-yl)-N-ethylpent-4-yn-2-amine.
| Compound Name | 1-(benzimidazol-1-yl)-N-ethylpent-4-yn-2-amine |
|---|---|
| PubChem CID | 105077571 |
| Molecular Formula | C14H17N3 |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.14 |
| IUPAC Name | 1-(benzimidazol-1-yl)-N-ethylpent-4-yn-2-amine |
| SMILES | C#CCC(Cn1cnc2ccccc21)NCC |
| InChI | InChI=1S/C14H17N3/c1-3-7-12(15-4-2)10-17-11-16-13-8-5-6-9-14(13)17/h1,5-6,8-9,11-12,15H,4,7,10H2,2H3 |
| InChIKey | DPNBMMARSBBARJ-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|