C30H32O13 — CID 10507790
[2-acetyl-4-methyl-3-[(2S,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyphenyl] benzoate (PubChem CID 10507790) has the molecular formula C30H32O13 and a molecular weight of 600.57 g/mol. Its IUPAC name is [2-acetyl-4-methyl-3-[(2S,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyphenyl] benzoate.
| Compound Name | [2-acetyl-4-methyl-3-[(2S,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyphenyl] benzoate |
|---|---|
| PubChem CID | 10507790 |
| Molecular Formula | C30H32O13 |
| Molecular Weight | 600.57 g/mol |
| Exact Mass | 600.18 |
| IUPAC Name | [2-acetyl-4-methyl-3-[(2S,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyphenyl] benzoate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](Oc2c(C)ccc(OC(=O)c3ccccc3)c2C(C)=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C30H32O13/c1-15-12-13-22(41-29(36)21-10-8-7-9-11-21)24(16(2)31)25(15)43-30-28(40-20(6)35)27(39-19(5)34)26(38-18(4)33)23(42-30)14-37-17(3)32/h7-13,23,26-28,30H,14H2,1-6H3/t23-,26-,27+,28-,30+/m1/s1 |
| InChIKey | IDQOHYWRLXIVQH-RHBSMATHSA-N |
| XLogP | 2.88 |
| TPSA | 167.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.57 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|