C36H42O4P2 — CID 10507797
[(2R,3R,5R,6R)-3-(diphenylphosphanylmethyl)-5,6-diethoxy-5,6-dimethyl-1,4-dioxan-2-yl]methyl-diphenylphosphane (PubChem CID 10507797) has the molecular formula C36H42O4P2 and a molecular weight of 600.68 g/mol. Its IUPAC name is [(2R,3R,5R,6R)-3-(diphenylphosphanylmethyl)-5,6-diethoxy-5,6-dimethyl-1,4-dioxan-2-yl]methyl-diphenylphosphane.
| Compound Name | [(2R,3R,5R,6R)-3-(diphenylphosphanylmethyl)-5,6-diethoxy-5,6-dimethyl-1,4-dioxan-2-yl]methyl-diphenylphosphane |
|---|---|
| PubChem CID | 10507797 |
| Molecular Formula | C36H42O4P2 |
| Molecular Weight | 600.68 g/mol |
| Exact Mass | 600.26 |
| IUPAC Name | [(2R,3R,5R,6R)-3-(diphenylphosphanylmethyl)-5,6-diethoxy-5,6-dimethyl-1,4-dioxan-2-yl]methyl-diphenylphosphane |
| SMILES | CCO[C@]1(C)O[C@@H](CP(c2ccccc2)c2ccccc2)[C@H](CP(c2ccccc2)c2ccccc2)O[C@@]1(C)OCC |
| InChI | InChI=1S/C36H42O4P2/c1-5-37-35(3)36(4,38-6-2)40-34(28-42(31-23-15-9-16-24-31)32-25-17-10-18-26-32)33(39-35)27-41(29-19-11-7-12-20-29)30-21-13-8-14-22-30/h7-26,33-34H,5-6,27-28H2,1-4H3/t33-,34-,35+,36+/m0/s1 |
| InChIKey | UIDAXMMSDMAXDO-CLLHQPRTSA-N |
| XLogP | 6.54 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.68 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|