C38H41BO6 — CID 10507855
(4S,5S)-2-[(1R,2R)-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]cyclopropyl]-4,5-bis[methoxy(diphenyl)methyl]-1,3,2-dioxaborolane (PubChem CID 10507855) has the molecular formula C38H41BO6 and a molecular weight of 604.55 g/mol. Its IUPAC name is (4S,5S)-2-[(1R,2R)-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]cyclopropyl]-4,5-bis[methoxy(diphenyl)methyl]-1,3,2-dioxaborolane.
| Compound Name | (4S,5S)-2-[(1R,2R)-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]cyclopropyl]-4,5-bis[methoxy(diphenyl)methyl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 10507855 |
| Molecular Formula | C38H41BO6 |
| Molecular Weight | 604.55 g/mol |
| Exact Mass | 604.30 |
| IUPAC Name | (4S,5S)-2-[(1R,2R)-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]cyclopropyl]-4,5-bis[methoxy(diphenyl)methyl]-1,3,2-dioxaborolane |
| SMILES | COC(c1ccccc1)(c1ccccc1)[C@H]1OB([C@@H]2C[C@H]2[C@H]2COC(C)(C)O2)O[C@@H]1C(OC)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C38H41BO6/c1-36(2)42-26-33(43-36)31-25-32(31)39-44-34(37(40-3,27-17-9-5-10-18-27)28-19-11-6-12-20-28)35(45-39)38(41-4,29-21-13-7-14-22-29)30-23-15-8-16-24-30/h5-24,31-35H,25-26H2,1-4H3/t31-,32-,33-,34+,35+/m1/s1 |
| InChIKey | CJSJVMYMJVQHLW-DWZFQDHRSA-N |
| XLogP | 6.98 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.55 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|