C35H42O9 — CID 10507888
[(1R,2R,4R,6S,8R,11R,12S,13R,16R,17R,19S)-17-acetyloxy-8-(furan-3-yl)-4,19-dihydroxy-1,9,11,16-tetramethyl-5,14-dioxapentacyclo[11.6.1.02,11.06,10.016,20]icos-9-en-12-yl] benzoate (PubChem CID 10507888) has the molecular formula C35H42O9 and a molecular weight of 606.71 g/mol. Its IUPAC name is [(1R,2R,4R,6S,8R,11R,12S,13R,16R,17R,19S)-17-acetyloxy-8-(furan-3-yl)-4,19-dihydroxy-1,9,11,16-tetramethyl-5,14-dioxapentacyclo[11.6.1.02,11.06,10.016,20]icos-9-en-12-yl] benzoate.
| Compound Name | [(1R,2R,4R,6S,8R,11R,12S,13R,16R,17R,19S)-17-acetyloxy-8-(furan-3-yl)-4,19-dihydroxy-1,9,11,16-tetramethyl-5,14-dioxapentacyclo[11.6.1.02,11.06,10.016,20]icos-9-en-12-yl] benzoate |
|---|---|
| PubChem CID | 10507888 |
| Molecular Formula | C35H42O9 |
| Molecular Weight | 606.71 g/mol |
| Exact Mass | 606.28 |
| IUPAC Name | [(1R,2R,4R,6S,8R,11R,12S,13R,16R,17R,19S)-17-acetyloxy-8-(furan-3-yl)-4,19-dihydroxy-1,9,11,16-tetramethyl-5,14-dioxapentacyclo[11.6.1.02,11.06,10.016,20]icos-9-en-12-yl] benzoate |
| SMILES | CC(=O)O[C@@H]1C[C@H](O)[C@@]2(C)C3C(OC[C@@]31C)[C@@H](OC(=O)c1ccccc1)[C@@]1(C)C3=C(C)[C@H](c4ccoc4)C[C@@H]3O[C@@H](O)C[C@@H]12 |
| InChI | InChI=1S/C35H42O9/c1-18-22(21-11-12-40-16-21)13-23-28(18)35(5)24(14-27(38)43-23)34(4)25(37)15-26(42-19(2)36)33(3)17-41-29(30(33)34)31(35)44-32(39)20-9-7-6-8-10-20/h6-12,16,22-27,29-31,37-38H,13-15,17H2,1-5H3/t22-,23+,24-,25+,26-,27-,29?,30?,31-,33-,34+,35-/m1/s1 |
| InChIKey | YVLWZIULQNWYGW-HKIFTSIISA-N |
| XLogP | 4.78 |
| TPSA | 124.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.71 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|