C30H62O3SiSn — CID 10508075
[(Z)-6-[4-(2,2-dimethyl-1,3-dioxolan-4-yl)-1-tributylstannylbutoxy]hex-2-enyl]-trimethylsilane (PubChem CID 10508075) has the molecular formula C30H62O3SiSn and a molecular weight of 617.62 g/mol. Its IUPAC name is [(Z)-6-[4-(2,2-dimethyl-1,3-dioxolan-4-yl)-1-tributylstannylbutoxy]hex-2-enyl]-trimethylsilane.
| Compound Name | [(Z)-6-[4-(2,2-dimethyl-1,3-dioxolan-4-yl)-1-tributylstannylbutoxy]hex-2-enyl]-trimethylsilane |
|---|---|
| PubChem CID | 10508075 |
| Molecular Formula | C30H62O3SiSn |
| Molecular Weight | 617.62 g/mol |
| Exact Mass | 618.35 |
| IUPAC Name | [(Z)-6-[4-(2,2-dimethyl-1,3-dioxolan-4-yl)-1-tributylstannylbutoxy]hex-2-enyl]-trimethylsilane |
| SMILES | CCCC[Sn](CCCC)(CCCC)C(CCCC1COC(C)(C)O1)OCCC/C=C\C[Si](C)(C)C |
| InChI | InChI=1S/C18H35O3Si.3C4H9.Sn/c1-18(2)20-16-17(21-18)12-8-10-14-19-13-9-6-7-11-15-22(3,4)5;3*1-3-4-2;/h7,11,14,17H,6,8-10,12-13,15-16H2,1-5H3;3*1,3-4H2,2H3;/b11-7-;;;; |
| InChIKey | RBPFQBIOYJJVBW-YIUUKBIWSA-N |
| XLogP | 9.76 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.62 |
| LogP ≤ 5 | 9.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|