C24H13Cl4FN2O6S — CID 10508087
3-O-[(E)-(1-carbamoyl-6-chloro-5-fluoro-2-oxoindol-3-ylidene)-thiophen-2-ylmethyl] 1-O-(2,2,2-trichloroethyl) benzene-1,3-dicarboxylate (PubChem CID 10508087) has the molecular formula C24H13Cl4FN2O6S and a molecular weight of 618.25 g/mol. Its IUPAC name is 3-O-[(E)-(1-carbamoyl-6-chloro-5-fluoro-2-oxoindol-3-ylidene)-thiophen-2-ylmethyl] 1-O-(2,2,2-trichloroethyl) benzene-1,3-dicarboxylate.
| Compound Name | 3-O-[(E)-(1-carbamoyl-6-chloro-5-fluoro-2-oxoindol-3-ylidene)-thiophen-2-ylmethyl] 1-O-(2,2,2-trichloroethyl) benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 10508087 |
| Molecular Formula | C24H13Cl4FN2O6S |
| Molecular Weight | 618.25 g/mol |
| Exact Mass | 615.92 |
| IUPAC Name | 3-O-[(E)-(1-carbamoyl-6-chloro-5-fluoro-2-oxoindol-3-ylidene)-thiophen-2-ylmethyl] 1-O-(2,2,2-trichloroethyl) benzene-1,3-dicarboxylate |
| SMILES | NC(=O)N1C(=O)/C(=C(/OC(=O)c2cccc(C(=O)OCC(Cl)(Cl)Cl)c2)c2cccs2)c2cc(F)c(Cl)cc21 |
| InChI | InChI=1S/C24H13Cl4FN2O6S/c25-14-9-16-13(8-15(14)29)18(20(32)31(16)23(30)35)19(17-5-2-6-38-17)37-22(34)12-4-1-3-11(7-12)21(33)36-10-24(26,27)28/h1-9H,10H2,(H2,30,35)/b19-18+ |
| InChIKey | FXGRAVSTXOXYRB-VHEBQXMUSA-N |
| XLogP | 6.22 |
| TPSA | 116.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.25 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|