C13H18O2 — CID 105081716
1-(3-methylphenoxy)hex-5-en-3-ol (PubChem CID 105081716) has the molecular formula C13H18O2 and a molecular weight of 206.28 g/mol. Its IUPAC name is 1-(3-methylphenoxy)hex-5-en-3-ol.
| Compound Name | 1-(3-methylphenoxy)hex-5-en-3-ol |
|---|---|
| PubChem CID | 105081716 |
| Molecular Formula | C13H18O2 |
| Molecular Weight | 206.28 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | 1-(3-methylphenoxy)hex-5-en-3-ol |
| SMILES | C=CCC(O)CCOc1cccc(C)c1 |
| InChI | InChI=1S/C13H18O2/c1-3-5-12(14)8-9-15-13-7-4-6-11(2)10-13/h3-4,6-7,10,12,14H,1,5,8-9H2,2H3 |
| InChIKey | CENCITGIFXXJSA-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.28 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|