C37H43N3O6 — CID 10508191
4-(3-methyl-1,4-dioxonaphthalen-2-yl)-N-[4-[3-[4-(3-methyl-1,4-dioxonaphthalen-2-yl)butanoylamino]propylamino]butyl]butanamide (PubChem CID 10508191) has the molecular formula C37H43N3O6 and a molecular weight of 625.77 g/mol. Its IUPAC name is 4-(3-methyl-1,4-dioxonaphthalen-2-yl)-N-[4-[3-[4-(3-methyl-1,4-dioxonaphthalen-2-yl)butanoylamino]propylamino]butyl]butanamide.
| Compound Name | 4-(3-methyl-1,4-dioxonaphthalen-2-yl)-N-[4-[3-[4-(3-methyl-1,4-dioxonaphthalen-2-yl)butanoylamino]propylamino]butyl]butanamide |
|---|---|
| PubChem CID | 10508191 |
| Molecular Formula | C37H43N3O6 |
| Molecular Weight | 625.77 g/mol |
| Exact Mass | 625.32 |
| IUPAC Name | 4-(3-methyl-1,4-dioxonaphthalen-2-yl)-N-[4-[3-[4-(3-methyl-1,4-dioxonaphthalen-2-yl)butanoylamino]propylamino]butyl]butanamide |
| SMILES | CC1=C(CCCC(=O)NCCCCNCCCNC(=O)CCCC2=C(C)C(=O)c3ccccc3C2=O)C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C37H43N3O6/c1-24-26(36(45)30-14-5-3-12-28(30)34(24)43)16-9-18-32(41)39-22-8-7-20-38-21-11-23-40-33(42)19-10-17-27-25(2)35(44)29-13-4-6-15-31(29)37(27)46/h3-6,12-15,38H,7-11,16-23H2,1-2H3,(H,39,41)(H,40,42) |
| InChIKey | KSAQOGHOAQCHGP-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 138.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.77 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|