C12H18OS — CID 105083105
1-(4,5,6,7-tetrahydro-1-benzothiophen-4-yl)butan-1-ol (PubChem CID 105083105) has the molecular formula C12H18OS and a molecular weight of 210.34 g/mol. Its IUPAC name is 1-(4,5,6,7-tetrahydro-1-benzothiophen-4-yl)butan-1-ol.
| Compound Name | 1-(4,5,6,7-tetrahydro-1-benzothiophen-4-yl)butan-1-ol |
|---|---|
| PubChem CID | 105083105 |
| Molecular Formula | C12H18OS |
| Molecular Weight | 210.34 g/mol |
| Exact Mass | 210.11 |
| IUPAC Name | 1-(4,5,6,7-tetrahydro-1-benzothiophen-4-yl)butan-1-ol |
| SMILES | CCCC(O)C1CCCc2sccc21 |
| InChI | InChI=1S/C12H18OS/c1-2-4-11(13)9-5-3-6-12-10(9)7-8-14-12/h7-9,11,13H,2-6H2,1H3 |
| InChIKey | QKSMBTXSHGVCPD-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.34 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |