C11H16N2O3S — CID 105083234
2-(1,1-dioxothiolan-3-yl)-1-(1-ethylpyrazol-4-yl)ethanone (PubChem CID 105083234) has the molecular formula C11H16N2O3S and a molecular weight of 256.33 g/mol. Its IUPAC name is 2-(1,1-dioxothiolan-3-yl)-1-(1-ethylpyrazol-4-yl)ethanone.
| Compound Name | 2-(1,1-dioxothiolan-3-yl)-1-(1-ethylpyrazol-4-yl)ethanone |
|---|---|
| PubChem CID | 105083234 |
| Molecular Formula | C11H16N2O3S |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | 2-(1,1-dioxothiolan-3-yl)-1-(1-ethylpyrazol-4-yl)ethanone |
| SMILES | CCn1cc(C(=O)CC2CCS(=O)(=O)C2)cn1 |
| InChI | InChI=1S/C11H16N2O3S/c1-2-13-7-10(6-12-13)11(14)5-9-3-4-17(15,16)8-9/h6-7,9H,2-5,8H2,1H3 |
| InChIKey | WZDKRDOSLMLHGX-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 69.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |