C17H21Br4N5O2 — CID 10508413
4,5-dibromo-N-[4-[3-[(4,5-dibromo-1H-pyrrole-2-carbonyl)amino]propylamino]butyl]-1H-pyrrole-2-carboxamide (PubChem CID 10508413) has the molecular formula C17H21Br4N5O2 and a molecular weight of 647.00 g/mol. Its IUPAC name is 4,5-dibromo-N-[4-[3-[(4,5-dibromo-1H-pyrrole-2-carbonyl)amino]propylamino]butyl]-1H-pyrrole-2-carboxamide.
| Compound Name | 4,5-dibromo-N-[4-[3-[(4,5-dibromo-1H-pyrrole-2-carbonyl)amino]propylamino]butyl]-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 10508413 |
| Molecular Formula | C17H21Br4N5O2 |
| Molecular Weight | 647.00 g/mol |
| Exact Mass | 642.84 |
| IUPAC Name | 4,5-dibromo-N-[4-[3-[(4,5-dibromo-1H-pyrrole-2-carbonyl)amino]propylamino]butyl]-1H-pyrrole-2-carboxamide |
| SMILES | O=C(NCCCCNCCCNC(=O)c1cc(Br)c(Br)[nH]1)c1cc(Br)c(Br)[nH]1 |
| InChI | InChI=1S/C17H21Br4N5O2/c18-10-8-12(25-14(10)20)16(27)23-6-2-1-4-22-5-3-7-24-17(28)13-9-11(19)15(21)26-13/h8-9,22,25-26H,1-7H2,(H,23,27)(H,24,28) |
| InChIKey | FUQALZZVMROPCY-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 101.81 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.00 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|