C11H15NO4S — CID 105084342
1-(2-methoxy-3-pyridinyl)-4-methylsulfonylbutan-1-one (PubChem CID 105084342) has the molecular formula C11H15NO4S and a molecular weight of 257.31 g/mol. Its IUPAC name is 1-(2-methoxy-3-pyridinyl)-4-methylsulfonylbutan-1-one.
| Compound Name | 1-(2-methoxy-3-pyridinyl)-4-methylsulfonylbutan-1-one |
|---|---|
| PubChem CID | 105084342 |
| Molecular Formula | C11H15NO4S |
| Molecular Weight | 257.31 g/mol |
| Exact Mass | 257.07 |
| IUPAC Name | 1-(2-methoxy-3-pyridinyl)-4-methylsulfonylbutan-1-one |
| SMILES | COc1ncccc1C(=O)CCCS(C)(=O)=O |
| InChI | InChI=1S/C11H15NO4S/c1-16-11-9(5-3-7-12-11)10(13)6-4-8-17(2,14)15/h3,5,7H,4,6,8H2,1-2H3 |
| InChIKey | YURYNJYGBWXLEN-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 73.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.31 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |