C13H16N2S — CID 105084395
N-methyl-1-(2-methyl-1,3-thiazol-4-yl)-2-phenylethanamine (PubChem CID 105084395) has the molecular formula C13H16N2S and a molecular weight of 232.35 g/mol. Its IUPAC name is N-methyl-1-(2-methyl-1,3-thiazol-4-yl)-2-phenylethanamine.
| Compound Name | N-methyl-1-(2-methyl-1,3-thiazol-4-yl)-2-phenylethanamine |
|---|---|
| PubChem CID | 105084395 |
| Molecular Formula | C13H16N2S |
| Molecular Weight | 232.35 g/mol |
| Exact Mass | 232.10 |
| IUPAC Name | N-methyl-1-(2-methyl-1,3-thiazol-4-yl)-2-phenylethanamine |
| SMILES | CNC(Cc1ccccc1)c1csc(C)n1 |
| InChI | InChI=1S/C13H16N2S/c1-10-15-13(9-16-10)12(14-2)8-11-6-4-3-5-7-11/h3-7,9,12,14H,8H2,1-2H3 |
| InChIKey | SLZSVWKYVZVIFU-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.35 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |