C38H66O8 — CID 10508457
4-[(13R)-13-[(2R,5R)-5-[(2S,5R)-5-[(4S,8S)-8-hexyl-1,3-dioxocan-4-yl]oxolan-2-yl]oxolan-2-yl]-10,13-dihydroxytridecyl]-2-methyl-2H-furan-5-one (PubChem CID 10508457) has the molecular formula C38H66O8 and a molecular weight of 650.94 g/mol. Its IUPAC name is 4-[(13R)-13-[(2R,5R)-5-[(2S,5R)-5-[(4S,8S)-8-hexyl-1,3-dioxocan-4-yl]oxolan-2-yl]oxolan-2-yl]-10,13-dihydroxytridecyl]-2-methyl-2H-furan-5-one.
| Compound Name | 4-[(13R)-13-[(2R,5R)-5-[(2S,5R)-5-[(4S,8S)-8-hexyl-1,3-dioxocan-4-yl]oxolan-2-yl]oxolan-2-yl]-10,13-dihydroxytridecyl]-2-methyl-2H-furan-5-one |
|---|---|
| PubChem CID | 10508457 |
| Molecular Formula | C38H66O8 |
| Molecular Weight | 650.94 g/mol |
| Exact Mass | 650.48 |
| IUPAC Name | 4-[(13R)-13-[(2R,5R)-5-[(2S,5R)-5-[(4S,8S)-8-hexyl-1,3-dioxocan-4-yl]oxolan-2-yl]oxolan-2-yl]-10,13-dihydroxytridecyl]-2-methyl-2H-furan-5-one |
| SMILES | CCCCCC[C@H]1CCC[C@@H]([C@H]2CC[C@@H]([C@H]3CC[C@H]([C@H](O)CCC(O)CCCCCCCCCC4=CC(C)OC4=O)O3)O2)OCO1 |
| InChI | InChI=1S/C38H66O8/c1-3-4-5-13-17-31-18-14-19-34(43-27-42-31)35-24-25-37(46-35)36-23-22-33(45-36)32(40)21-20-30(39)16-12-10-8-6-7-9-11-15-29-26-28(2)44-38(29)41/h26,28,30-37,39-40H,3-25,27H2,1-2H3/t28?,30?,31-,32+,33+,34-,35+,36+,37-/m0/s1 |
| InChIKey | DGMTZJBMTJAMJZ-TXRSSHADSA-N |
| XLogP | 7.85 |
| TPSA | 103.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.94 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|