C38H40N2O8 — CID 10508473
[(1S,14S)-9,20,21,25-tetramethoxy-7,23-dioxa-15,30-diazaheptacyclo[22.6.2.23,6.18,12.114,18.027,31.022,33]hexatriaconta-3(36),4,6(35),8,10,12(34),18(33),19,21,24,26,31-dodecaen-19-yl] acetate (PubChem CID 10508473) has the molecular formula C38H40N2O8 and a molecular weight of 652.74 g/mol. Its IUPAC name is [(1S,14S)-9,20,21,25-tetramethoxy-7,23-dioxa-15,30-diazaheptacyclo[22.6.2.23,6.18,12.114,18.027,31.022,33]hexatriaconta-3(36),4,6(35),8,10,12(34),18(33),19,21,24,26,31-dodecaen-19-yl] acetate.
| Compound Name | [(1S,14S)-9,20,21,25-tetramethoxy-7,23-dioxa-15,30-diazaheptacyclo[22.6.2.23,6.18,12.114,18.027,31.022,33]hexatriaconta-3(36),4,6(35),8,10,12(34),18(33),19,21,24,26,31-dodecaen-19-yl] acetate |
|---|---|
| PubChem CID | 10508473 |
| Molecular Formula | C38H40N2O8 |
| Molecular Weight | 652.74 g/mol |
| Exact Mass | 652.28 |
| IUPAC Name | [(1S,14S)-9,20,21,25-tetramethoxy-7,23-dioxa-15,30-diazaheptacyclo[22.6.2.23,6.18,12.114,18.027,31.022,33]hexatriaconta-3(36),4,6(35),8,10,12(34),18(33),19,21,24,26,31-dodecaen-19-yl] acetate |
| SMILES | COc1ccc2cc1Oc1ccc(cc1)C[C@@H]1NCCc3cc(OC)c(cc31)Oc1c(OC)c(OC)c(OC(C)=O)c3c1[C@H](C2)NCC3 |
| InChI | InChI=1S/C38H40N2O8/c1-21(41)46-35-26-13-15-40-29-17-23-8-11-30(42-2)32(18-23)47-25-9-6-22(7-10-25)16-28-27-20-33(31(43-3)19-24(27)12-14-39-28)48-36(34(26)29)38(45-5)37(35)44-4/h6-11,18-20,28-29,39-40H,12-17H2,1-5H3/t28-,29-/m0/s1 |
| InChIKey | XGTBHJPDBGQAFU-VMPREFPWSA-N |
| XLogP | 6.40 |
| TPSA | 105.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.74 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|