C13H14BrFN2O — CID 105086618
2-(5-bromo-2-fluorophenyl)-1-(2,5-dimethylpyrazol-3-yl)ethanol (PubChem CID 105086618) has the molecular formula C13H14BrFN2O and a molecular weight of 313.17 g/mol. Its IUPAC name is 2-(5-bromo-2-fluorophenyl)-1-(2,5-dimethylpyrazol-3-yl)ethanol.
| Compound Name | 2-(5-bromo-2-fluorophenyl)-1-(2,5-dimethylpyrazol-3-yl)ethanol |
|---|---|
| PubChem CID | 105086618 |
| Molecular Formula | C13H14BrFN2O |
| Molecular Weight | 313.17 g/mol |
| Exact Mass | 312.03 |
| IUPAC Name | 2-(5-bromo-2-fluorophenyl)-1-(2,5-dimethylpyrazol-3-yl)ethanol |
| SMILES | Cc1cc(C(O)Cc2cc(Br)ccc2F)n(C)n1 |
| InChI | InChI=1S/C13H14BrFN2O/c1-8-5-12(17(2)16-8)13(18)7-9-6-10(14)3-4-11(9)15/h3-6,13,18H,7H2,1-2H3 |
| InChIKey | LGDISAWOXIBYPK-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.17 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |