C23H21ClN2O4 — CID 1050870
ethyl (4S)-6-amino-4-[3-(4-chlorophenoxy)phenyl]-5-cyano-2-ethyl-4H-pyran-3-carboxylate (PubChem CID 1050870) has the molecular formula C23H21ClN2O4 and a molecular weight of 424.88 g/mol. Its IUPAC name is ethyl (4S)-6-amino-4-[3-(4-chlorophenoxy)phenyl]-5-cyano-2-ethyl-4H-pyran-3-carboxylate.
| Compound Name | ethyl (4S)-6-amino-4-[3-(4-chlorophenoxy)phenyl]-5-cyano-2-ethyl-4H-pyran-3-carboxylate |
|---|---|
| PubChem CID | 1050870 |
| Molecular Formula | C23H21ClN2O4 |
| Molecular Weight | 424.88 g/mol |
| Exact Mass | 424.12 |
| IUPAC Name | ethyl (4S)-6-amino-4-[3-(4-chlorophenoxy)phenyl]-5-cyano-2-ethyl-4H-pyran-3-carboxylate |
| SMILES | CCOC(=O)C1=C(CC)OC(N)=C(C#N)[C@@H]1c1cccc(Oc2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C23H21ClN2O4/c1-3-19-21(23(27)28-4-2)20(18(13-25)22(26)30-19)14-6-5-7-17(12-14)29-16-10-8-15(24)9-11-16/h5-12,20H,3-4,26H2,1-2H3/t20-/m0/s1 |
| InChIKey | HXUNLVHMJZWDNQ-FQEVSTJZSA-N |
| XLogP | 5.17 |
| TPSA | 94.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.88 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |