C23H33BrO6S6 — CID 10508714
6-bromohexyl 2-(5,8,11,14-tetraoxa-2,17,19,21-tetrathiabicyclo[16.3.0]henicos-1(18)-en-20-ylidene)-1,3-dithiole-4-carboxylate (PubChem CID 10508714) has the molecular formula C23H33BrO6S6 and a molecular weight of 677.82 g/mol. Its IUPAC name is 6-bromohexyl 2-(5,8,11,14-tetraoxa-2,17,19,21-tetrathiabicyclo[16.3.0]henicos-1(18)-en-20-ylidene)-1,3-dithiole-4-carboxylate.
| Compound Name | 6-bromohexyl 2-(5,8,11,14-tetraoxa-2,17,19,21-tetrathiabicyclo[16.3.0]henicos-1(18)-en-20-ylidene)-1,3-dithiole-4-carboxylate |
|---|---|
| PubChem CID | 10508714 |
| Molecular Formula | C23H33BrO6S6 |
| Molecular Weight | 677.82 g/mol |
| Exact Mass | 675.98 |
| IUPAC Name | 6-bromohexyl 2-(5,8,11,14-tetraoxa-2,17,19,21-tetrathiabicyclo[16.3.0]henicos-1(18)-en-20-ylidene)-1,3-dithiole-4-carboxylate |
| SMILES | O=C(OCCCCCCBr)C1=CSC(=C2SC3=C(SCCOCCOCCOCCOCCS3)S2)S1 |
| InChI | InChI=1S/C23H33BrO6S6/c24-5-3-1-2-4-6-30-19(25)18-17-33-22(34-18)23-35-20-21(36-23)32-16-14-29-12-10-27-8-7-26-9-11-28-13-15-31-20/h17H,1-16H2 |
| InChIKey | GMFAMEIGHXHUPS-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.82 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|