C10H12N2OS2 — CID 105087594
2-(5-ethylthiophen-2-yl)-1-(1,2,5-thiadiazol-3-yl)ethanol (PubChem CID 105087594) has the molecular formula C10H12N2OS2 and a molecular weight of 240.35 g/mol. Its IUPAC name is 2-(5-ethylthiophen-2-yl)-1-(1,2,5-thiadiazol-3-yl)ethanol.
| Compound Name | 2-(5-ethylthiophen-2-yl)-1-(1,2,5-thiadiazol-3-yl)ethanol |
|---|---|
| PubChem CID | 105087594 |
| Molecular Formula | C10H12N2OS2 |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.04 |
| IUPAC Name | 2-(5-ethylthiophen-2-yl)-1-(1,2,5-thiadiazol-3-yl)ethanol |
| SMILES | CCc1ccc(CC(O)c2cnsn2)s1 |
| InChI | InChI=1S/C10H12N2OS2/c1-2-7-3-4-8(14-7)5-10(13)9-6-11-15-12-9/h3-4,6,10,13H,2,5H2,1H3 |
| InChIKey | QNEGDGIEOLMICD-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |