C35H32Br2N4O — CID 10508773
38-methoxy-17,24-diaza-1,9-diazoniaheptacyclo[23.6.2.29,16.219,22.13,7.010,15.026,31]octatriaconta-1(32),3(38),4,6,9(37),10,12,14,16(36),19,21,25(33),26,28,30,34-hexadecaene dibromide (PubChem CID 10508773) has the molecular formula C35H32Br2N4O and a molecular weight of 684.48 g/mol. Its IUPAC name is 38-methoxy-17,24-diaza-1,9-diazoniaheptacyclo[23.6.2.29,16.219,22.13,7.010,15.026,31]octatriaconta-1(32),3(38),4,6,9(37),10,12,14,16(36),19,21,25(33),26,28,30,34-hexadecaene dibromide.
| Compound Name | 38-methoxy-17,24-diaza-1,9-diazoniaheptacyclo[23.6.2.29,16.219,22.13,7.010,15.026,31]octatriaconta-1(32),3(38),4,6,9(37),10,12,14,16(36),19,21,25(33),26,28,30,34-hexadecaene dibromide |
|---|---|
| PubChem CID | 10508773 |
| Molecular Formula | C35H32Br2N4O |
| Molecular Weight | 684.48 g/mol |
| Exact Mass | 682.09 |
| IUPAC Name | 38-methoxy-17,24-diaza-1,9-diazoniaheptacyclo[23.6.2.29,16.219,22.13,7.010,15.026,31]octatriaconta-1(32),3(38),4,6,9(37),10,12,14,16(36),19,21,25(33),26,28,30,34-hexadecaene dibromide |
| SMILES | COc1c2cccc1C[n+]1ccc(c3ccccc31)NCc1ccc(cc1)CNc1cc[n+](c3ccccc13)C2.[Br-].[Br-] |
| InChI | InChI=1S/C35H30N4O.2BrH/c1-40-35-27-7-6-8-28(35)24-39-20-18-32(30-10-3-5-12-34(30)39)37-22-26-15-13-25(14-16-26)21-36-31-17-19-38(23-27)33-11-4-2-9-29(31)33;;/h2-20H,21-24H2,1H3;2*1H/b36-31-,37-32+;; |
| InChIKey | MNKDKHJXHSSQDF-AWTJSHMJSA-N |
| XLogP | 0.22 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.48 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|