C35H32N4O+2 — CID 10508774
38-methoxy-17,24-diaza-1,9-diazoniaheptacyclo[23.6.2.29,16.219,22.13,7.010,15.026,31]octatriaconta-1(32),3(38),4,6,9(37),10,12,14,16(36),19,21,25(33),26,28,30,34-hexadecaene (PubChem CID 10508774) has the molecular formula C35H32N4O+2 and a molecular weight of 524.67 g/mol. Its IUPAC name is 38-methoxy-17,24-diaza-1,9-diazoniaheptacyclo[23.6.2.29,16.219,22.13,7.010,15.026,31]octatriaconta-1(32),3(38),4,6,9(37),10,12,14,16(36),19,21,25(33),26,28,30,34-hexadecaene.
| Compound Name | 38-methoxy-17,24-diaza-1,9-diazoniaheptacyclo[23.6.2.29,16.219,22.13,7.010,15.026,31]octatriaconta-1(32),3(38),4,6,9(37),10,12,14,16(36),19,21,25(33),26,28,30,34-hexadecaene |
|---|---|
| PubChem CID | 10508774 |
| Molecular Formula | C35H32N4O+2 |
| Molecular Weight | 524.67 g/mol |
| Exact Mass | 524.26 |
| IUPAC Name | 38-methoxy-17,24-diaza-1,9-diazoniaheptacyclo[23.6.2.29,16.219,22.13,7.010,15.026,31]octatriaconta-1(32),3(38),4,6,9(37),10,12,14,16(36),19,21,25(33),26,28,30,34-hexadecaene |
| SMILES | COc1c2cccc1C[n+]1ccc(c3ccccc31)NCc1ccc(cc1)CNc1cc[n+](c3ccccc13)C2 |
| InChI | InChI=1S/C35H30N4O/c1-40-35-27-7-6-8-28(35)24-39-20-18-32(30-10-3-5-12-34(30)39)37-22-26-15-13-25(14-16-26)21-36-31-17-19-38(23-27)33-11-4-2-9-29(31)33/h2-20H,21-24H2,1H3/p+2/b36-31+,37-32+ |
| InChIKey | MEHJJTIFAFXFIT-NBTMAVPQSA-P |
| XLogP | 6.21 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.67 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|