C18H16N2O — CID 105087972
1-(3,6-dimethylpyridazin-4-yl)-2-naphthalen-1-ylethanone (PubChem CID 105087972) has the molecular formula C18H16N2O and a molecular weight of 276.34 g/mol. Its IUPAC name is 1-(3,6-dimethylpyridazin-4-yl)-2-naphthalen-1-ylethanone.
| Compound Name | 1-(3,6-dimethylpyridazin-4-yl)-2-naphthalen-1-ylethanone |
|---|---|
| PubChem CID | 105087972 |
| Molecular Formula | C18H16N2O |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | 1-(3,6-dimethylpyridazin-4-yl)-2-naphthalen-1-ylethanone |
| SMILES | Cc1cc(C(=O)Cc2cccc3ccccc23)c(C)nn1 |
| InChI | InChI=1S/C18H16N2O/c1-12-10-17(13(2)20-19-12)18(21)11-15-8-5-7-14-6-3-4-9-16(14)15/h3-10H,11H2,1-2H3 |
| InChIKey | RLTRKADZFOSJTI-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |