C16H11Cl2FOS — CID 105088041
2-(3,4-dichlorophenyl)-1-(5-fluoro-1-benzothiophen-2-yl)ethanol (PubChem CID 105088041) has the molecular formula C16H11Cl2FOS and a molecular weight of 341.23 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)-1-(5-fluoro-1-benzothiophen-2-yl)ethanol.
| Compound Name | 2-(3,4-dichlorophenyl)-1-(5-fluoro-1-benzothiophen-2-yl)ethanol |
|---|---|
| PubChem CID | 105088041 |
| Molecular Formula | C16H11Cl2FOS |
| Molecular Weight | 341.23 g/mol |
| Exact Mass | 339.99 |
| IUPAC Name | 2-(3,4-dichlorophenyl)-1-(5-fluoro-1-benzothiophen-2-yl)ethanol |
| SMILES | OC(Cc1ccc(Cl)c(Cl)c1)c1cc2cc(F)ccc2s1 |
| InChI | InChI=1S/C16H11Cl2FOS/c17-12-3-1-9(5-13(12)18)6-14(20)16-8-10-7-11(19)2-4-15(10)21-16/h1-5,7-8,14,20H,6H2 |
| InChIKey | JYWUZBFDSLRKEI-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.23 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |