About CID 10508936
CID 10508936 (PubChem CID 10508936) has the molecular formula C33H47F9NOSi2
and a molecular weight of 700.90 g/mol.
Molecular Properties
| Compound Name | CID 10508936 |
| PubChem CID | 10508936 |
| Molecular Formula | C33H47F9NOSi2 |
| Molecular Weight | 700.90 g/mol |
| Exact Mass | 700.31 |
| IUPAC Name | — |
| SMILES | C[Si](C[C@H]1/C(=C/C2CCCCC2)CN2CCCC[C@@H]2[C@@H]1O[Si](C)(C)C(C)(C)C)c1cc(C(F)(F)F)c(C(F)(F)F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C33H47F9NOSi2/c1-30(2,3)46(5,6)44-29-24(22(16-21-12-8-7-9-13-21)19-43-15-11-10-14-27(29)43)20-45(4)23-17-25(31(34,35)36)28(33(40,41)42)26(18-23)32(37,38)39/h16-18,21,24,27,29H,7-15,19-20H2,1-6H3/b22-16+/t24-,27+,29+/m0/s1 |
| InChIKey | VPRNGHWBEBYXCF-CJUSLHJKSA-N |
| XLogP | 10.46 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 700.90 |
| LogP ≤ 5 | 10.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze CID 10508936 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 10508936?
The IUPAC name of CID 10508936 (CID 10508936) is not available.
What is the SMILES notation for CID 10508936?
The canonical SMILES for CID 10508936 is C[Si](C[C@H]1/C(=C/C2CCCCC2)CN2CCCC[C@@H]2[C@@H]1O[Si](C)(C)C(C)(C)C)c1cc(C(F)(F)F)c(C(F)(F)F)c(C(F)(F)F)c1.
What is the InChIKey of CID 10508936?
The InChIKey is VPRNGHWBEBYXCF-CJUSLHJKSA-N. The full InChI is InChI=1S/C33H47F9NOSi2/c1-30(2,3)46(5,6)44-29-24(22(16-21-12-8-7-9-13-21)19-43-15-11-10-14-27(29)43)20-45(4)23-17-25(31(34,35)36)28(33(40,41)42)26(18-23)32(37,38)39/h16-18,21,24,27,29H,7-15,19-20H2,1-6H3/b22-16+/t24-,27+,29+/m0/s1.
What are the key properties of CID 10508936?
CID 10508936 has a molecular weight of 700.90 g/mol, XLogP of 10.46, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 10508936 is sourced from PubChem (CID 10508936), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).