C34H71NO7Si4 — CID 10509066
1-[(2R,3R,4S,5R,6R)-3,4,5-tris[[tert-butyl(dimethyl)silyl]oxy]-6-[[tert-butyl(dimethyl)silyl]oxymethyl]oxan-2-yl]pyrrolidine-2,5-dione (PubChem CID 10509066) has the molecular formula C34H71NO7Si4 and a molecular weight of 718.29 g/mol. Its IUPAC name is 1-[(2R,3R,4S,5R,6R)-3,4,5-tris[[tert-butyl(dimethyl)silyl]oxy]-6-[[tert-butyl(dimethyl)silyl]oxymethyl]oxan-2-yl]pyrrolidine-2,5-dione.
| Compound Name | 1-[(2R,3R,4S,5R,6R)-3,4,5-tris[[tert-butyl(dimethyl)silyl]oxy]-6-[[tert-butyl(dimethyl)silyl]oxymethyl]oxan-2-yl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 10509066 |
| Molecular Formula | C34H71NO7Si4 |
| Molecular Weight | 718.29 g/mol |
| Exact Mass | 717.43 |
| IUPAC Name | 1-[(2R,3R,4S,5R,6R)-3,4,5-tris[[tert-butyl(dimethyl)silyl]oxy]-6-[[tert-butyl(dimethyl)silyl]oxymethyl]oxan-2-yl]pyrrolidine-2,5-dione |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](N2C(=O)CCC2=O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C34H71NO7Si4/c1-31(2,3)43(13,14)38-23-24-27(40-44(15,16)32(4,5)6)28(41-45(17,18)33(7,8)9)29(42-46(19,20)34(10,11)12)30(39-24)35-25(36)21-22-26(35)37/h24,27-30H,21-23H2,1-20H3/t24-,27-,28+,29-,30-/m1/s1 |
| InChIKey | RMIALLICXRQNDG-YMIJDRNOSA-N |
| XLogP | 9.05 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.29 |
| LogP ≤ 5 | 9.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|