About 1-(2-methyl-1,3-thiazol-4-yl)-2-(oxan-4-yl)ethanone
1-(2-methyl-1,3-thiazol-4-yl)-2-(oxan-4-yl)ethanone (PubChem CID 105092030) has the molecular formula C11H15NO2S
and a molecular weight of 225.31 g/mol. Its IUPAC name is 1-(2-methyl-1,3-thiazol-4-yl)-2-(oxan-4-yl)ethanone.
Molecular Properties
| Compound Name | 1-(2-methyl-1,3-thiazol-4-yl)-2-(oxan-4-yl)ethanone |
| PubChem CID | 105092030 |
| Molecular Formula | C11H15NO2S |
| Molecular Weight | 225.31 g/mol |
| Exact Mass | 225.08 |
| IUPAC Name | 1-(2-methyl-1,3-thiazol-4-yl)-2-(oxan-4-yl)ethanone |
| SMILES | Cc1nc(C(=O)CC2CCOCC2)cs1 |
| InChI | InChI=1S/C11H15NO2S/c1-8-12-10(7-15-8)11(13)6-9-2-4-14-5-3-9/h7,9H,2-6H2,1H3 |
| InChIKey | RJFCVRHYAKCWPT-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.31 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(2-methyl-1,3-thiazol-4-yl)-2-(oxan-4-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-methyl-1,3-thiazol-4-yl)-2-(oxan-4-yl)ethanone?
The IUPAC name of 1-(2-methyl-1,3-thiazol-4-yl)-2-(oxan-4-yl)ethanone (CID 105092030) is 1-(2-methyl-1,3-thiazol-4-yl)-2-(oxan-4-yl)ethanone.
What is the SMILES notation for 1-(2-methyl-1,3-thiazol-4-yl)-2-(oxan-4-yl)ethanone?
The canonical SMILES for 1-(2-methyl-1,3-thiazol-4-yl)-2-(oxan-4-yl)ethanone is Cc1nc(C(=O)CC2CCOCC2)cs1.
What is the InChIKey of 1-(2-methyl-1,3-thiazol-4-yl)-2-(oxan-4-yl)ethanone?
The InChIKey is RJFCVRHYAKCWPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO2S/c1-8-12-10(7-15-8)11(13)6-9-2-4-14-5-3-9/h7,9H,2-6H2,1H3.
What are the key properties of 1-(2-methyl-1,3-thiazol-4-yl)-2-(oxan-4-yl)ethanone?
1-(2-methyl-1,3-thiazol-4-yl)-2-(oxan-4-yl)ethanone has a molecular weight of 225.31 g/mol, XLogP of 2.45, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-methyl-1,3-thiazol-4-yl)-2-(oxan-4-yl)ethanone is sourced from PubChem (CID 105092030), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).