C15H17BrO2 — CID 105093405
1-(7-bromo-1-benzofuran-2-yl)-4,4-dimethylpentan-1-one (PubChem CID 105093405) has the molecular formula C15H17BrO2 and a molecular weight of 309.20 g/mol. Its IUPAC name is 1-(7-bromo-1-benzofuran-2-yl)-4,4-dimethylpentan-1-one.
| Compound Name | 1-(7-bromo-1-benzofuran-2-yl)-4,4-dimethylpentan-1-one |
|---|---|
| PubChem CID | 105093405 |
| Molecular Formula | C15H17BrO2 |
| Molecular Weight | 309.20 g/mol |
| Exact Mass | 308.04 |
| IUPAC Name | 1-(7-bromo-1-benzofuran-2-yl)-4,4-dimethylpentan-1-one |
| SMILES | CC(C)(C)CCC(=O)c1cc2cccc(Br)c2o1 |
| InChI | InChI=1S/C15H17BrO2/c1-15(2,3)8-7-12(17)13-9-10-5-4-6-11(16)14(10)18-13/h4-6,9H,7-8H2,1-3H3 |
| InChIKey | HDKAHJPLDDIYDB-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.20 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |