C36H52Br2N4O4 — CID 10509364
3-(1,3-dioxoisoindol-2-yl)propyl-[10-[3-(1,3-dioxoisoindol-2-yl)propyl-dimethylazaniumyl]decyl]-dimethylazanium dibromide (PubChem CID 10509364) has the molecular formula C36H52Br2N4O4 and a molecular weight of 764.64 g/mol. Its IUPAC name is 3-(1,3-dioxoisoindol-2-yl)propyl-[10-[3-(1,3-dioxoisoindol-2-yl)propyl-dimethylazaniumyl]decyl]-dimethylazanium dibromide.
| Compound Name | 3-(1,3-dioxoisoindol-2-yl)propyl-[10-[3-(1,3-dioxoisoindol-2-yl)propyl-dimethylazaniumyl]decyl]-dimethylazanium dibromide |
|---|---|
| PubChem CID | 10509364 |
| Molecular Formula | C36H52Br2N4O4 |
| Molecular Weight | 764.64 g/mol |
| Exact Mass | 762.24 |
| IUPAC Name | 3-(1,3-dioxoisoindol-2-yl)propyl-[10-[3-(1,3-dioxoisoindol-2-yl)propyl-dimethylazaniumyl]decyl]-dimethylazanium dibromide |
| SMILES | C[N+](C)(CCCCCCCCCC[N+](C)(C)CCCN1C(=O)c2ccccc2C1=O)CCCN1C(=O)c2ccccc2C1=O.[Br-].[Br-] |
| InChI | InChI=1S/C36H52N4O4.2BrH/c1-39(2,27-17-23-37-33(41)29-19-11-12-20-30(29)34(37)42)25-15-9-7-5-6-8-10-16-26-40(3,4)28-18-24-38-35(43)31-21-13-14-22-32(31)36(38)44;;/h11-14,19-22H,5-10,15-18,23-28H2,1-4H3;2*1H/q+2;;/p-2 |
| InChIKey | KIQUBEVPRJBSFS-UHFFFAOYSA-L |
| XLogP | -0.36 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 764.64 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|